bio chemistry Flashcards
organic vs inorganic compounds
organic compounds - hydrocarbons that contain hydrogen AND carbon
inorganic compounds - compounds that do not contain hydrogen and carbon together
formula for carbohydrates
CH2O
formula for glucose
C6H12O6
4 organic compounds
- carbs
- proteins
- lipids
- nucleid acid
4 most common elements of earth (chon)
- carbon
- hydrogen
- oxygen
- nitrogen
(iodine)
4 reasons why water is the most important inorganic compound
- our body composition is made up of 85% water
- where most chemical reactions take place
- keeps us at homeostasis
- best for solvent molecules
true or false most organisms contain both organic and inorganic compounds
true
proteins, starches, and DNA are all what
organic compounds
what are carbohydrates made up of
sugar compounds made up of hydrogen, carbon, and oxygen
what are the ratio of carbohydrates
1 carbon, 2 hydrogen, 1 oxygen (1:2:1)
define disaccharides + 3 examples
2 sugars molecules together (maltose, lactose, trehalose)
define polysaccharides + 3 examples
more than two sugars together (Starch, cellulose, glycogen)
define monosaccharide + examples 3
one sugar (fructose, galactose, xylose)
what process put two sugars together by removing a water molecule
dehydration synthesis
dehydration synthesis equation
C6H1206(glucose)+C12H22O11+H20
in dehydration synthesis, the h20 will always be on the
right side
anything that ends with an ase is
an enzyme needed to start a chemistry reaction
anything that ends with an ose
carbohydrate
hydrolysis of a maltose
C12H220+H20 –> C6H106+ C6H1206
where is the energy usually stored in a molecule
the bonds between the atoms
the glucose molecules are the building blocks of what class macromolecules
carbohydrates
can you picture the structure of a carbohydrate
if not look over and press 1
https://www.google.com/search?q=structure+of+a+carbo&rlz=1CATRYQ_enUS1126&oq=structure+of+a+carbo&gs_lcrp=EgZjaHJvbWUyBggAEEUYOTIHCAEQABiABDIHCAIQABiABDIHCAMQABiABDIHCAQQABiABDIHCAUQABiABDIHCAYQABiABDIHCAcQABiABDIHCAgQABiABDIHCAkQABiABNIBCDI1NzJqMGo5qAIAsAIA&sourceid=chrome&ie=UTF-8&safe=active&ssui=on
can you picture the structure of a lipid
if not look over it and press 1
https://www.google.com/search?q=lipids+structure&sca_esv=c64f92f75d6f9f24&rlz=1CATRYQ_enUS1126&udm=2&biw=1300&bih=699&ei=Zoc-Z_bELMimptQP-7yGoAY&ved=0ahUKEwj2j73sneyJAxVIk4kEHXueAWQQ4dUDCBA&uact=5&oq=lipids+structure&gs_lp=EgNpbWciEGxpcGlkcyBzdHJ1Y3R1cmUyCBAAGIAEGLEDMgUQABiABDIFEAAYgAQyBRAAGIAEMgUQABiABDIFEAAYgAQyBRAAGIAEMgUQABiABDIFEAAYgAQyBRAAGIAESMoaUJ8CWIkacAJ4AJABAJgBugGgAeYFqgEEMTAuMbgBA8gBAPgBAZgCDaACzwbCAg0QABiABBixAxhDGIoFwgIGEAAYBxgewgIKEAAYgAQYQxiKBcICBxAAGIAEGAqYAwCIBgGSBwQxMi4xoAfrOg&sclient=img&safe=active&ssui=on#vhid=siosuKH1YbZf0M&vssid=mosaic
can you picture the structure of an amino acid
yes or no
can the picture the structure of a dipeptide
yes or no