Organic/ Equillibrium Flashcards
What makes a substance happen faster ?
Breaking It into smaller pieces
In which reaction of gases would INCREASING the PRESSURE favor the forward reaction ?
A. 2A 3 B 2 <=> 3A 2 + 2B 2
B. A 2 + B 2 <=> 2AB
C. 3A 2 + 2B 3 <=> 6AB
D. A + B <=> AB
B
For the polymer, polyvinyl chloride (PVC), ~ CH2CH(Cl)CH2CH(Cl)CH2CH(Cl) ~ what is the repeating subunit ?
CH2CH(Cl)
Which of the following is the monomer that is the subunit for proteins ?
A. Polypeptide
B. Steroid
C. Amino Acids
D. Starch
C
Which is the most important characteristic for Carbon that makes it so versitile ?
A. 6 protons
B. Molar mass of 12.0g/mole
C. 4 covalent bonds
D. Reacts well with oxygen
C
2 different monomers joined to each other form
A polymer
What do all organic compounds contain?
Carbon
Calculate the amount of 2.5 M Ca(OH)2 is needed to neutralize 30 ml of a 3.5M HCl
0.013 L Ca(OH)2
or
13.125 mL Ca(OH)2
How much energy is needed to change 30 grams of Copper from 20^C to 60^C? (spHt of Copper = 0.4 j/g^C)
^ = degrees
Answer: E = 480 J
Work:
E= SpHt • Mass • change in temp.
E= (0.4)(30)(40)
E= 480 J
Given the reaction, Fe2O3 + 3CO ==> 2Fe + 3CO2, how much Fe2O3 are needed to completely react with 84 grams of CO?
159.64g Fe2O3
What is the molar concentration of a NaCl solution having 10 grams of NaCl in 100 mL of water?
Answer: 1.7 M NaCl
Work:
1 mol
10 • ———- = 0.17 mol NaCl
58.45g
100/ 1000 = 0.1 L
- 17 mol NaCl
- ————– = 1.7 M NaCl - 1 L NaCl
Which pH indicates high ionization of a base?
A. 2 B. 6 C. 7 D. 8 E. 13
E
N2 + 3H2 <=> 2NH3 + 92kj
Adding more NH3 will cause the reaction to …
Shift towards the reactants
Which of the following is likely an acid ?
A. HNO3
B. Ca(OH)2
C. NaCl
D. NH3
A
If the H(fus) H2O = 6 kJ/mole and the H(vap) H20 = 40 kJ/mole, which is true?
A. Takes more energy to heat water than melt it
B. Takes more energy to melt water than boil it
C. Takes more energy to boil water than freeze it
C
