Ethene Flashcards
(17 cards)
What’s an unsaturated hydrocarbon
Unsaturated = contains at least one c to c double bond Hydrocarbon= consists of hydrogen and carbon only
Chemical equation for ethene
C(2)h(5)oh=c(2)h(4)+h(2)o
Draw labelled diagram of apparatus
Ethanol and glass wool in test tube ( horizontally above Bunsen burner)
Al2o3( small lump in middle of test tube)
Ethene
Water
How is ethene collected ? What property of ethene makes this possible ? Explain
Over water
Ethene is non polar
Water is polar so non polar compounds won’t dissolve in it
How would u demonstrate that ethene is unsaturated
Shake with bromine water goes from red / brown to colourless
Describe the smell and appearance of ethene
Colourless gas with sweetish smell
How does the flame of ethene compare to ethene?
Yellow luminous and non smoky
What type of reaction is used in the production of ethene
Elimination
Describe the appearance of the powder in the test tube
White
What is the purpose of the glass wool
To hold the ethanol in place
What is the purpose of alimminum oxide
Catalyst
3 safety precautions carried out during experiment
No naked flames = ethene is flammable explosive
Remove delivery tube when heating is stopped = prevent suck back
Wear safety glasses = danger of explosion
Eq for combustion of ethene
C(2)h(4) + 3o(2) = 2co(2) + 2h(2)o
Major use for ethene
Ripening fruit
At what stage in the procedure is suck back more likely to occur
When heating is stopped
How can it be prevented
Remove delivery tube from water
What is the possible outcome for suckback
Explosion