Carbohydrates Flashcards
What is the most abundant biomolecule?
carbs
What are carbs used for? (4 answers)
- cell walls
- lubricating skeletal joints
- cell recognition
- adhesion
What do “glycoconjugates” do?
provide “labels” for cellular destinations
What is the general formula for carbs?
Cn(H20)n
What is an “aldose”?
carbonyl carbon (C=O) is 1st in chain
What is an “ketose”?
carbonyl carbon in 2nd position
What is the general formula for a monosaccharide?
(C-H2O)n
What are monosaccharides?
aldehydes or ketones containing 2 or more hydroxyl groups
What 2 smallest monosaccharides are isomers?
- glyceraldehyde
- dihydroxyacetone
Draw D-glucose
CH20HCH(OH)CH(OH)CH(OH)CH(OH)CHO
Draw D-mannose
CH20HCH(OH)CH(OH)CH(OH)CH(OH)CHO
Draw D-galactose
CH20HCH(OH)CH(OH)CH(OH)CH(OH)CHO
Draw D-fructose
CH20HCH(OH)CH(OH)CH(OH)C=OCH2OH
What is “stereochemistry”?
study of arrangement of atoms in 3D space
What is a “stereoisomer”?
molecules that have the same bonds connecting the same atoms but different orientations of bonds
What is “chirality”?
asymmetric molecules
What sugar is present in humans L or D?
D
What form are amino acids in, L or D for human usage?
L
What is an “epimer”?
differ only in configuration around one or many chiral carbons
What is an example of an epimer?
D-glucose and D-mannose
What is an “enantiomer”?
a chiral compound and its mirror image
What is an “optical isomer” an example of?
stereoisomer