5A - Acid-Base Equilibria Flashcards
(40 cards)
Mnemonic: Brotons-Lowry and Lewis model
Therefore Protons: Bronsted-Lowry
And remember Lewis dot model is drawing of electrons
What is an amphoteric species?
This is a species in which it has the ability to function both as an acid and base/ proton donor and proton acceptor/ electron acceptor and electron donor respectively.
Find the molarity of OH- if the concentration of H3O+ is 2.2x10-3 M.
H2O + H2O ⇔ H3O+ + OH-
Kw = KH3O+KOH- = 1x10-14 M / 2.2x10-3
~0.5 x 10-11 => 5 x 10-2M
Why is the understanding of water so important on the MCAT?
It is important to understand the behavior of acidic and basic compounds in water and because most reactions function in water.
This is why we need to understand the behavior of water and it pH
Which of the following thermodynamic quantities is important in the value of Kw? A. Concentration B. Pressure C. Volume D. Temperature
D. Temperature. @ 25ºC or 298K, the Kw = 10-14 Increase in temperature from 298, leads to an increase in Kw value and decrease in temperature from 298K leads to a decrease in Kw value
While the temperature of 298K does not change, the [ ] of H3O+ and OH- does have the ability to change, but Kw will never change
Others do not affect Kw
Lemon juice to have [H3O+] = 2.2 x 10-3 M, what is the OH- [ ]? Is this an acidic, basic, or neutral solution?
[H3O+] [OH-] = 1 x 10-14 M
1 x 10-14 M = 2.2 x 10-3 M [OH-]
[OH-] = 1 x 10-14 M / 2.2 x 10-3 M = 4.45 x 10-12 M
[H3O+] vs [OH-]
2.2 x 10-3 M vs 4.45 x 10-12 M
Because 2.2 x 10-3 M > 4.45 x 10-12 M, the solution is in fact acidic.
Explain the factors that can change Kw.
The magnitude of Kw like other equilibrium constants, will not unless the temperature changes. This means that the magnitudes of OH- and H3O+ will while the solution is neutral.
Increase in changes in temperature leads to an increase in Kw in value [likely due to the endothermic nature of autoionization.
Changes to the Kw value, changes the significance of the pH scale. This is why it is important in looking at the conditions presented to you on the test
Identify which reactant are amphoteric species in the following reactions. For the species, determine if the compound is amphoteric: HCO3- + HBr ⇔ H2CO3 + Br
Amphoteric reactant: HCO3-
This species is amphiprotic as well
Identify which reactant are amphoteric species in the following reactions. For the species, determine if the compound is amphoteric: 3HCl + Al(OH)3 ⇔ AlCl3
Amphoteric species: Al(OH)3 Note: HCL is not able accept as a base, but it does function as an acid. Note: this definition is not in reference to its conjugate species
This is not an amphiprotic species because it does not release H+ into solution
Identify which reactant are amphoteric species in the following reactions. For the species, determine if the compound is amphoteric: 2HBr + ZnO ⇔ ZnBr2 + H2O
The amphoteric species is ZnO
This is not an amphiprotic species because it does not release H+ into solution
What are the missing associated variables with a solution with a pH of 4: [H3O+], pOH. [OH-], acid or base?
pH = 4 [H3O+] = 1 x 10-4 M pOH = 10 [OH-] = 1x10-10M This is an acid! This is determined by the pH
A compound with 8.89x10-4M H3O+. What are the associated: pH, pOH, and [OH-]? Is this an acid or base?
[H3O+] = 8.89x10-4 pH = -log(8.89x10-4) = ~4-0.889 = ~3.2 pOH = 14 - 3.2 = ~10.8 [OH-] = 1x10-14 / 8.89x10-4 = ~0.112 x 10-14- -4 = 0.112 x 10-10 = 1.12 x 10-9 M This compound is an acid!
You’re working with an unknown element in lab and find their pOH = 5.19. Find the associated pH, H+ and OH- concentrations. Is this compound an acid or base?
pOH = 5.19 pH = 14 - 5.19 = ~ 8.8 [H3O+] = Remember that pH = -log[H+] = 8.8 => -1x10-8.8 M ~ 1x10-9 M (rounding the fractional exponents can allow you to give a good approximation)
What is the pH when you have an [OH-] concentration equal to 9.84x10-8 M? A. 8.67 B. 7.92 C. 6.99 D. 5.43
pOH = -log[OH-] = -log(9.84x10-8)
8 - 0.984 = 7.016
14 - 7.016 = 6.98 = pH AKA C. 6.99
If orange juice has a hydronium concentration of 3.2x10-4M, what is the pH?
pH = -log[3.2x10-4]
~ 4 - 0.32 = 3.68
= 3.5
Calculate the pH of an aqueous solution that contains 0.11g of Ca(OH)2 in a total volume of 250 mL
Ca(OH)2 -> Ca2+ + 2OH- | Note: This metal ion completely dissociates, this means that the total concentration of OH made in the product is double
Molar mass of Ca(OH)2 = 74g/mol 0.11gCa(OH)2 / (74g/mol) = 0.0014 mol 0.0014 mol/250mL = 0.0056 M CaOH2 [OH-] = 0.0056 M CaOH2 (2OH-/CaOH2) = 0.0112 M OH pOH = -log[OH-] = -log[0.0112] = 1.95 pH + pOH = 14 14 - 1.95 = 12.05 = pH
The Bicarb system favors the reactants more and makes for a very good buffer system hence why it is found in the blood to combat CO2 levels.
Predict is the conjugate base of HCl will be a strong or weak?
Remember that the stronger the acid/base, the weaker the conjugate base/acid.
think of this as competing base ranks Cl will try to pick up H on the product side. However since HCl is so good at donating an electron, the Cl will have a hard time doing what it desires. This is why strong acids and bases dissociate completely in one direction only and there is no reverse reaction because the conjugate acid is weak
The pH of 0.03M solution of nitric acid in water. What is the pH of the solution?
HNO3 (nitric acid) + H2O -> NO3- + H3O+
Remember that this is a strong acid and will completely dissociate. This is demonstrated by a single headed arrow
This also means that there are 0.03M of NO3- and 0.03M of H3O+ produced
pH = -log[H3O+] = -log[0.03] = -log[3x10-2] = ~2-0.3 = 1.7
NaCH3COO is added into neutral pH of water. What are the results?
when the salt dissociates into Na and CH3COO: Na will not affect the pH
CH3COO- - this will change pH. Why? Acetic acid is a weak acid, and when weak acids are dissociated, they make strong conjugate bases! This means that the ion formed form the salt will strip the H from the H2O, creating lots of OH- readily, producing a basic solution
NaCH3COO + H2O -> Na+ + OH- CH3COOH
Remember that Na and OH are conjugates of a strong acids, and therefore are weak and will not tend to interact with one another
Increase in OH- leads to an increase in pH
This means that a salt formed from a WEAK acid and a STRONG base, you’ll produce a basic solution
This salt ClNH4 is added into neutral pH water
Remember Cl- does not change the pH of the solution much
NH4+ will affect the pH of the water by a lot. Weak base NH3 creates a strong conjugate acid NH4+ This means that in water, this acid will donate the H+ to water, to form H3O+
ClNH4 + H3O+ -> NH3 + Cl- + H3O+
Therefore when the salt of a STRONG acid and a weak base is dissolved in water, it will produce an acidic solution
Calculate the concentration of H3O+ in a 2.0M aqueous solution of acetic acid, CH3COOH. (Note: Ka1.8x10-5)
CH3COOH(aq) ⇔ CH3COO-(aq) + H3O+ (aq) 2.0M 0M 0M -x +x +x 2.0 - x +x +x pKa = [H3O+][CH3COO-]/[CH3COOH] pKa = x2/2.0M-x Assume x far smaller than 2.0 pKa = x2 / 2 x2 = pKa*2 => 1.8x10-5*2 x = √(3.6x10-6*) = 6x10-3 H3O+
If a compound has a Ka value»_space; Water, what does it mean about its behavior in solution? How does this compare with a solution that has only a slightly higher Ka than water?
Compound with a Ka»_space; water means that it will behave as a strong acid, therefore it will dissociate completely in water.
Having a Ka slightly greater than water means the acid is a weak acid with minimal dissociation
If a compound has a Kb value»_space; water, what does it mean about its behavior in solution? How does this compare with a solution that has only a slightly higher Kb than water?
This compound with a very high Kb value compared to water means that this base is a strong base and therefore will dissociate completely in water.
Having a Kb slightly greater than water means that this compound is a base, but a very weak base and therefore will not dissociate completely but only partially.
What is the acid dissociation constant for this equation: H2O + HCl => H3O+ + Cl-
In this example the BLB - Water - this is the molecule that accepts the H
BLA - HCl, there this is the molecule that donates the H
Strong acids - donate H very easily. This means that 100% of the reactants will become products
Ka = [H3O+] [Cl-] / [HCl]
The dissociation value will be based on how much product is made from the reaction. Because strong acids dissociate completely, Ka will be very large for forward reactions
Large value in numerator / small number in the denominator
In conclusion Ka > > 1 for strong acids